About 6-ethyl-2-(2-methylpropyl)-2H-1,4-diazepine
6-ethyl-2-(2-methylpropyl)-2H-1,4-diazepine (PubChem CID 123827965) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 6-ethyl-2-(2-methylpropyl)-2H-1,4-diazepine.
Molecular Properties
| Compound Name | 6-ethyl-2-(2-methylpropyl)-2H-1,4-diazepine |
| PubChem CID | 123827965 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 6-ethyl-2-(2-methylpropyl)-2H-1,4-diazepine |
| SMILES | CCC1=CN=CC(CC(C)C)N=C1 |
| InChI | InChI=1S/C11H18N2/c1-4-10-6-12-8-11(13-7-10)5-9(2)3/h6-9,11H,4-5H2,1-3H3 |
| InChIKey | GMAXKTOMYOQNMQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethyl-2-(2-methylpropyl)-2H-1,4-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2-(2-methylpropyl)-2H-1,4-diazepine?
The IUPAC name of 6-ethyl-2-(2-methylpropyl)-2H-1,4-diazepine (CID 123827965) is 6-ethyl-2-(2-methylpropyl)-2H-1,4-diazepine.
What is the SMILES notation for 6-ethyl-2-(2-methylpropyl)-2H-1,4-diazepine?
The canonical SMILES for 6-ethyl-2-(2-methylpropyl)-2H-1,4-diazepine is CCC1=CN=CC(CC(C)C)N=C1.
What is the InChIKey of 6-ethyl-2-(2-methylpropyl)-2H-1,4-diazepine?
The InChIKey is GMAXKTOMYOQNMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-4-10-6-12-8-11(13-7-10)5-9(2)3/h6-9,11H,4-5H2,1-3H3.
What are the key properties of 6-ethyl-2-(2-methylpropyl)-2H-1,4-diazepine?
6-ethyl-2-(2-methylpropyl)-2H-1,4-diazepine has a molecular weight of 178.28 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2-(2-methylpropyl)-2H-1,4-diazepine is sourced from PubChem (CID 123827965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).