C18H20N4O2S — CID 123828150
2-[2-hydroxy-4-[4-(1-hydroxyethyl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaen-3-yl]cyclohexyl]acetonitrile (PubChem CID 123828150) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is 2-[2-hydroxy-4-[4-(1-hydroxyethyl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaen-3-yl]cyclohexyl]acetonitrile.
| Compound Name | 2-[2-hydroxy-4-[4-(1-hydroxyethyl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaen-3-yl]cyclohexyl]acetonitrile |
|---|---|
| PubChem CID | 123828150 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2-[2-hydroxy-4-[4-(1-hydroxyethyl)-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaen-3-yl]cyclohexyl]acetonitrile |
| SMILES | CC(O)c1nc2cnc3ccsc3c2n1C1CCC(CC#N)C(O)C1 |
| InChI | InChI=1S/C18H20N4O2S/c1-10(23)18-21-14-9-20-13-5-7-25-17(13)16(14)22(18)12-3-2-11(4-6-19)15(24)8-12/h5,7,9-12,15,23-24H,2-4,8H2,1H3 |
| InChIKey | MCSNWMJEXIVNDF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 94.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |