C14H25N3 — CID 123828627
1-[3-[(1S,3S)-1,2,2,3-tetramethylcyclopentyl]propyl]-1,2,4-triazole (PubChem CID 123828627) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 1-[3-[(1S,3S)-1,2,2,3-tetramethylcyclopentyl]propyl]-1,2,4-triazole.
| Compound Name | 1-[3-[(1S,3S)-1,2,2,3-tetramethylcyclopentyl]propyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 123828627 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 1-[3-[(1S,3S)-1,2,2,3-tetramethylcyclopentyl]propyl]-1,2,4-triazole |
| SMILES | C[C@H]1CC[C@@](C)(CCCn2cncn2)C1(C)C |
| InChI | InChI=1S/C14H25N3/c1-12-6-8-14(4,13(12,2)3)7-5-9-17-11-15-10-16-17/h10-12H,5-9H2,1-4H3/t12-,14+/m0/s1 |
| InChIKey | YUGDPLALDYQFPP-GXTWGEPZSA-N |
| XLogP | 3.52 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |