C18H19FN2O5 — CID 123828692
2-[[1-[[(1S,2S)-2-(4-fluorophenyl)cyclopropyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid (PubChem CID 123828692) has the molecular formula C18H19FN2O5 and a molecular weight of 362.36 g/mol. Its IUPAC name is 2-[[1-[[(1S,2S)-2-(4-fluorophenyl)cyclopropyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[1-[[(1S,2S)-2-(4-fluorophenyl)cyclopropyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 123828692 |
| Molecular Formula | C18H19FN2O5 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-[[1-[[(1S,2S)-2-(4-fluorophenyl)cyclopropyl]methyl]-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1C(=O)CCN(C[C@H]2C[C@@H]2c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C18H19FN2O5/c19-12-3-1-10(2-4-12)13-7-11(13)9-21-6-5-14(22)16(18(21)26)17(25)20-8-15(23)24/h1-4,11,13,16H,5-9H2,(H,20,25)(H,23,24)/t11-,13-,16?/m1/s1 |
| InChIKey | DPULIRDYDQWJCI-BXKKICEVSA-N |
| XLogP | 0.55 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|