About [1,2,4]triazolo[4,3-b]isoindol-5-one
[1,2,4]triazolo[4,3-b]isoindol-5-one (PubChem CID 123828894) has the molecular formula C9H5N3O
and a molecular weight of 171.16 g/mol. Its IUPAC name is [1,2,4]triazolo[4,3-b]isoindol-5-one.
Molecular Properties
| Compound Name | [1,2,4]triazolo[4,3-b]isoindol-5-one |
| PubChem CID | 123828894 |
| Molecular Formula | C9H5N3O |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | [1,2,4]triazolo[4,3-b]isoindol-5-one |
| SMILES | O=C1c2ccccc2-c2nncn21 |
| InChI | InChI=1S/C9H5N3O/c13-9-7-4-2-1-3-6(7)8-11-10-5-12(8)9/h1-5H |
| InChIKey | SLNMUELXIWFUSA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,2,4]triazolo[4,3-b]isoindol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2,4]triazolo[4,3-b]isoindol-5-one?
The IUPAC name of [1,2,4]triazolo[4,3-b]isoindol-5-one (CID 123828894) is [1,2,4]triazolo[4,3-b]isoindol-5-one.
What is the SMILES notation for [1,2,4]triazolo[4,3-b]isoindol-5-one?
The canonical SMILES for [1,2,4]triazolo[4,3-b]isoindol-5-one is O=C1c2ccccc2-c2nncn21.
What is the InChIKey of [1,2,4]triazolo[4,3-b]isoindol-5-one?
The InChIKey is SLNMUELXIWFUSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N3O/c13-9-7-4-2-1-3-6(7)8-11-10-5-12(8)9/h1-5H.
What are the key properties of [1,2,4]triazolo[4,3-b]isoindol-5-one?
[1,2,4]triazolo[4,3-b]isoindol-5-one has a molecular weight of 171.16 g/mol, XLogP of 0.95, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2,4]triazolo[4,3-b]isoindol-5-one is sourced from PubChem (CID 123828894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).