C62H46O — CID 123829053
10,10-di(cyclohexa-1,5-dien-1-yl)-2,7-bis(3,5-diphenylphenyl)anthracen-9-one (PubChem CID 123829053) has the molecular formula C62H46O and a molecular weight of 807.05 g/mol. Its IUPAC name is 10,10-di(cyclohexa-1,5-dien-1-yl)-2,7-bis(3,5-diphenylphenyl)anthracen-9-one.
| Compound Name | 10,10-di(cyclohexa-1,5-dien-1-yl)-2,7-bis(3,5-diphenylphenyl)anthracen-9-one |
|---|---|
| PubChem CID | 123829053 |
| Molecular Formula | C62H46O |
| Molecular Weight | 807.05 g/mol |
| Exact Mass | 806.35 |
| IUPAC Name | 10,10-di(cyclohexa-1,5-dien-1-yl)-2,7-bis(3,5-diphenylphenyl)anthracen-9-one |
| SMILES | O=C1c2cc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)ccc2C(C2=CCCC=C2)(C2=CCCC=C2)c2ccc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)cc21 |
| InChI | InChI=1S/C62H46O/c63-61-57-41-47(53-37-49(43-19-7-1-8-20-43)35-50(38-53)44-21-9-2-10-22-44)31-33-59(57)62(55-27-15-5-16-28-55,56-29-17-6-18-30-56)60-34-32-48(42-58(60)61)54-39-51(45-23-11-3-12-24-45)36-52(40-54)46-25-13-4-14-26-46/h1-4,7-15,17,19-42H,5-6,16,18H2 |
| InChIKey | QSBLLJLEHOFZFB-UHFFFAOYSA-N |
| XLogP | 16.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.05 |
| LogP ≤ 5 | 16.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |