C19H23F2N3O — CID 123829514
5-(2,6-dimethylmorpholin-4-yl)-2-(2,6-dimethyl-4-pyridinyl)-3,6-difluoroaniline (PubChem CID 123829514) has the molecular formula C19H23F2N3O and a molecular weight of 347.41 g/mol. Its IUPAC name is 5-(2,6-dimethylmorpholin-4-yl)-2-(2,6-dimethyl-4-pyridinyl)-3,6-difluoroaniline.
| Compound Name | 5-(2,6-dimethylmorpholin-4-yl)-2-(2,6-dimethyl-4-pyridinyl)-3,6-difluoroaniline |
|---|---|
| PubChem CID | 123829514 |
| Molecular Formula | C19H23F2N3O |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 5-(2,6-dimethylmorpholin-4-yl)-2-(2,6-dimethyl-4-pyridinyl)-3,6-difluoroaniline |
| SMILES | Cc1cc(-c2c(F)cc(N3CC(C)OC(C)C3)c(F)c2N)cc(C)n1 |
| InChI | InChI=1S/C19H23F2N3O/c1-10-5-14(6-11(2)23-10)17-15(20)7-16(18(21)19(17)22)24-8-12(3)25-13(4)9-24/h5-7,12-13H,8-9,22H2,1-4H3 |
| InChIKey | KRCWMDGYWRPJGJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|