C21H26N2O — CID 123829563
ethane;4-(5-methyl-5-phenyl-4H-1,2-oxazol-3-yl)benzonitrile (PubChem CID 123829563) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is ethane;4-(5-methyl-5-phenyl-4H-1,2-oxazol-3-yl)benzonitrile.
| Compound Name | ethane;4-(5-methyl-5-phenyl-4H-1,2-oxazol-3-yl)benzonitrile |
|---|---|
| PubChem CID | 123829563 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | ethane;4-(5-methyl-5-phenyl-4H-1,2-oxazol-3-yl)benzonitrile |
| SMILES | CC.CC.CC1(c2ccccc2)CC(c2ccc(C#N)cc2)=NO1 |
| InChI | InChI=1S/C17H14N2O.2C2H6/c1-17(15-5-3-2-4-6-15)11-16(19-20-17)14-9-7-13(12-18)8-10-14;2*1-2/h2-10H,11H2,1H3;2*1-2H3 |
| InChIKey | MARUBQXCDKCZBZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |