C15H26N2O2 — CID 123830280
ethane;methyl 3-pyridin-2-ylpyrrolidine-1-carboxylate (PubChem CID 123830280) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is ethane;methyl 3-pyridin-2-ylpyrrolidine-1-carboxylate.
| Compound Name | ethane;methyl 3-pyridin-2-ylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123830280 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | ethane;methyl 3-pyridin-2-ylpyrrolidine-1-carboxylate |
| SMILES | CC.CC.COC(=O)N1CCC(c2ccccn2)C1 |
| InChI | InChI=1S/C11H14N2O2.2C2H6/c1-15-11(14)13-7-5-9(8-13)10-4-2-3-6-12-10;2*1-2/h2-4,6,9H,5,7-8H2,1H3;2*1-2H3 |
| InChIKey | CJPGWJBMFKCSDM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |