C24H22F5N3O — CID 123830346
2-[2-(2,4-difluorophenyl)-5-iminohept-1-enyl]-4-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1H-pyrimidin-6-one (PubChem CID 123830346) has the molecular formula C24H22F5N3O and a molecular weight of 463.45 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)-5-iminohept-1-enyl]-4-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(2,4-difluorophenyl)-5-iminohept-1-enyl]-4-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 123830346 |
| Molecular Formula | C24H22F5N3O |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)-5-iminohept-1-enyl]-4-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1H-pyrimidin-6-one |
| SMILES | [H]/N=C(\CC)CCC(=CC1N=C(c2ccc(C(F)(F)F)cc2)CC(=O)N1)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H22F5N3O/c1-2-18(30)9-5-15(19-10-8-17(25)12-20(19)26)11-22-31-21(13-23(33)32-22)14-3-6-16(7-4-14)24(27,28)29/h3-4,6-8,10-12,22,30H,2,5,9,13H2,1H3,(H,32,33)/b15-11?,30-18+ |
| InChIKey | PORATFUZTJVVJR-ZVXDFHCASA-N |
| XLogP | 5.91 |
| TPSA | 65.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|