C20H25F3N6 — CID 123830792
N-[(1R)-1-cyclobutylethyl]-2-isocyano-7-[[4-(trifluoromethyl)cyclohexyl]methyl]purin-6-amine (PubChem CID 123830792) has the molecular formula C20H25F3N6 and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[(1R)-1-cyclobutylethyl]-2-isocyano-7-[[4-(trifluoromethyl)cyclohexyl]methyl]purin-6-amine.
| Compound Name | N-[(1R)-1-cyclobutylethyl]-2-isocyano-7-[[4-(trifluoromethyl)cyclohexyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 123830792 |
| Molecular Formula | C20H25F3N6 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | N-[(1R)-1-cyclobutylethyl]-2-isocyano-7-[[4-(trifluoromethyl)cyclohexyl]methyl]purin-6-amine |
| SMILES | [C-]#[N+]c1nc(N[C@H](C)C2CCC2)c2c(ncn2CC2CCC(C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C20H25F3N6/c1-12(14-4-3-5-14)26-18-16-17(27-19(24-2)28-18)25-11-29(16)10-13-6-8-15(9-7-13)20(21,22)23/h11-15H,3-10H2,1H3,(H,26,27,28)/t12-,13?,15?/m1/s1 |
| InChIKey | ISJYETLCUAMNNV-DNOWBOINSA-N |
| XLogP | 5.35 |
| TPSA | 59.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|