C32H31BrClFN4O4 — CID 123830851
methyl N-[15-[4-(6-bromo-3-chloro-2-fluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10-methyl-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,16,18-hexaen-5-yl]carbamate (PubChem CID 123830851) has the molecular formula C32H31BrClFN4O4 and a molecular weight of 669.98 g/mol. Its IUPAC name is methyl N-[15-[4-(6-bromo-3-chloro-2-fluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10-methyl-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,16,18-hexaen-5-yl]carbamate.
| Compound Name | methyl N-[15-[4-(6-bromo-3-chloro-2-fluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10-methyl-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,16,18-hexaen-5-yl]carbamate |
|---|---|
| PubChem CID | 123830851 |
| Molecular Formula | C32H31BrClFN4O4 |
| Molecular Weight | 669.98 g/mol |
| Exact Mass | 668.12 |
| IUPAC Name | methyl N-[15-[4-(6-bromo-3-chloro-2-fluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10-methyl-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,16,18-hexaen-5-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(=O)C(C)CCCCC(N1CCC(c3c(Br)ccc(Cl)c3F)=CC1=O)c1cc-2ccn1 |
| InChI | InChI=1S/C32H31BrClFN4O4/c1-18-5-3-4-6-27(39-14-12-20(16-28(39)40)29-23(33)9-10-24(34)30(29)35)26-15-19(11-13-36-26)22-8-7-21(37-32(42)43-2)17-25(22)38-31(18)41/h7-11,13,15-18,27H,3-6,12,14H2,1-2H3,(H,37,42)(H,38,41) |
| InChIKey | HQABXMYJBGFHTL-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.98 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|