About 2-(3-methylcyclohexa-2,4-dien-1-yl)ethanimine
2-(3-methylcyclohexa-2,4-dien-1-yl)ethanimine (PubChem CID 123830887) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 2-(3-methylcyclohexa-2,4-dien-1-yl)ethanimine.
Molecular Properties
| Compound Name | 2-(3-methylcyclohexa-2,4-dien-1-yl)ethanimine |
| PubChem CID | 123830887 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 2-(3-methylcyclohexa-2,4-dien-1-yl)ethanimine |
| SMILES | [H]/N=C/CC1C=C(C)C=CC1 |
| InChI | InChI=1S/C9H13N/c1-8-3-2-4-9(7-8)5-6-10/h2-3,6-7,9-10H,4-5H2,1H3/b10-6+ |
| InChIKey | MNVJAKCJYLHPPX-UXBLZVDNSA-N |
| XLogP | 2.55 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methylcyclohexa-2,4-dien-1-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylcyclohexa-2,4-dien-1-yl)ethanimine?
The IUPAC name of 2-(3-methylcyclohexa-2,4-dien-1-yl)ethanimine (CID 123830887) is 2-(3-methylcyclohexa-2,4-dien-1-yl)ethanimine.
What is the SMILES notation for 2-(3-methylcyclohexa-2,4-dien-1-yl)ethanimine?
The canonical SMILES for 2-(3-methylcyclohexa-2,4-dien-1-yl)ethanimine is [H]/N=C/CC1C=C(C)C=CC1.
What is the InChIKey of 2-(3-methylcyclohexa-2,4-dien-1-yl)ethanimine?
The InChIKey is MNVJAKCJYLHPPX-UXBLZVDNSA-N. The full InChI is InChI=1S/C9H13N/c1-8-3-2-4-9(7-8)5-6-10/h2-3,6-7,9-10H,4-5H2,1H3/b10-6+.
What are the key properties of 2-(3-methylcyclohexa-2,4-dien-1-yl)ethanimine?
2-(3-methylcyclohexa-2,4-dien-1-yl)ethanimine has a molecular weight of 135.21 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylcyclohexa-2,4-dien-1-yl)ethanimine is sourced from PubChem (CID 123830887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).