C5H20O8Si5 — CID 123831411
2,4,8-trihydroxy-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 123831411) has the molecular formula C5H20O8Si5 and a molecular weight of 348.64 g/mol. Its IUPAC name is 2,4,8-trihydroxy-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,4,8-trihydroxy-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 123831411 |
| Molecular Formula | C5H20O8Si5 |
| Molecular Weight | 348.64 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 2,4,8-trihydroxy-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | C[SiH]1O[Si](C)(O)O[SiH](C)O[Si](C)(O)O[Si](C)(O)O1 |
| InChI | InChI=1S/C5H20O8Si5/c1-14-9-16(3,6)10-15(2)12-18(5,8)13-17(4,7)11-14/h6-8,14-15H,1-5H3 |
| InChIKey | HRCHLHPUILDCKJ-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.64 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|