C10H12N4S2 — CID 123831691
N-methylsulfanyl-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanamine (PubChem CID 123831691) has the molecular formula C10H12N4S2 and a molecular weight of 252.37 g/mol. Its IUPAC name is N-methylsulfanyl-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanamine.
| Compound Name | N-methylsulfanyl-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 123831691 |
| Molecular Formula | C10H12N4S2 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | N-methylsulfanyl-2-(2-pyrimidin-2-yl-1,3-thiazol-4-yl)ethanamine |
| SMILES | CSNCCc1csc(-c2ncccn2)n1 |
| InChI | InChI=1S/C10H12N4S2/c1-15-13-6-3-8-7-16-10(14-8)9-11-4-2-5-12-9/h2,4-5,7,13H,3,6H2,1H3 |
| InChIKey | DQISPKJXJDVUGY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|