About 4-[3-bromo-3-(6-fluoro-1,3-benzothiazol-2-yl)propoxy]-3-methoxyphenol
4-[3-bromo-3-(6-fluoro-1,3-benzothiazol-2-yl)propoxy]-3-methoxyphenol (PubChem CID 123832581) has the molecular formula C17H15BrFNO3S
and a molecular weight of 412.28 g/mol. Its IUPAC name is 4-[3-bromo-3-(6-fluoro-1,3-benzothiazol-2-yl)propoxy]-3-methoxyphenol.
Molecular Properties
| Compound Name | 4-[3-bromo-3-(6-fluoro-1,3-benzothiazol-2-yl)propoxy]-3-methoxyphenol |
| PubChem CID | 123832581 |
| Molecular Formula | C17H15BrFNO3S |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 4-[3-bromo-3-(6-fluoro-1,3-benzothiazol-2-yl)propoxy]-3-methoxyphenol |
| SMILES | COc1cc(O)ccc1OCCC(Br)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C17H15BrFNO3S/c1-22-15-9-11(21)3-5-14(15)23-7-6-12(18)17-20-13-4-2-10(19)8-16(13)24-17/h2-5,8-9,12,21H,6-7H2,1H3 |
| InChIKey | RUQPGDSBXDZPEC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-bromo-3-(6-fluoro-1,3-benzothiazol-2-yl)propoxy]-3-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-bromo-3-(6-fluoro-1,3-benzothiazol-2-yl)propoxy]-3-methoxyphenol?
The IUPAC name of 4-[3-bromo-3-(6-fluoro-1,3-benzothiazol-2-yl)propoxy]-3-methoxyphenol (CID 123832581) is 4-[3-bromo-3-(6-fluoro-1,3-benzothiazol-2-yl)propoxy]-3-methoxyphenol.
What is the SMILES notation for 4-[3-bromo-3-(6-fluoro-1,3-benzothiazol-2-yl)propoxy]-3-methoxyphenol?
The canonical SMILES for 4-[3-bromo-3-(6-fluoro-1,3-benzothiazol-2-yl)propoxy]-3-methoxyphenol is COc1cc(O)ccc1OCCC(Br)c1nc2ccc(F)cc2s1.
What is the InChIKey of 4-[3-bromo-3-(6-fluoro-1,3-benzothiazol-2-yl)propoxy]-3-methoxyphenol?
The InChIKey is RUQPGDSBXDZPEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15BrFNO3S/c1-22-15-9-11(21)3-5-14(15)23-7-6-12(18)17-20-13-4-2-10(19)8-16(13)24-17/h2-5,8-9,12,21H,6-7H2,1H3.
What are the key properties of 4-[3-bromo-3-(6-fluoro-1,3-benzothiazol-2-yl)propoxy]-3-methoxyphenol?
4-[3-bromo-3-(6-fluoro-1,3-benzothiazol-2-yl)propoxy]-3-methoxyphenol has a molecular weight of 412.28 g/mol, XLogP of 5.05, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-bromo-3-(6-fluoro-1,3-benzothiazol-2-yl)propoxy]-3-methoxyphenol is sourced from PubChem (CID 123832581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).