C8H7F3N2O — CID 123832586
3-penta-2,4-dien-2-yl-5-(trifluoromethyl)-1,2,4-oxadiazole (PubChem CID 123832586) has the molecular formula C8H7F3N2O and a molecular weight of 204.15 g/mol. Its IUPAC name is 3-penta-2,4-dien-2-yl-5-(trifluoromethyl)-1,2,4-oxadiazole.
| Compound Name | 3-penta-2,4-dien-2-yl-5-(trifluoromethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 123832586 |
| Molecular Formula | C8H7F3N2O |
| Molecular Weight | 204.15 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 3-penta-2,4-dien-2-yl-5-(trifluoromethyl)-1,2,4-oxadiazole |
| SMILES | C=CC=C(C)c1noc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H7F3N2O/c1-3-4-5(2)6-12-7(14-13-6)8(9,10)11/h3-4H,1H2,2H3 |
| InChIKey | LGJHMDWQOQCUCC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.15 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|