C20H23NO2S — CID 123832847
(4E)-2-(benzenesulfonyl)-5-cyclohexa-1,5-dien-1-yl-N-methylhepta-1,4-dien-3-imine (PubChem CID 123832847) has the molecular formula C20H23NO2S and a molecular weight of 341.48 g/mol. Its IUPAC name is (4E)-2-(benzenesulfonyl)-5-cyclohexa-1,5-dien-1-yl-N-methylhepta-1,4-dien-3-imine.
| Compound Name | (4E)-2-(benzenesulfonyl)-5-cyclohexa-1,5-dien-1-yl-N-methylhepta-1,4-dien-3-imine |
|---|---|
| PubChem CID | 123832847 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (4E)-2-(benzenesulfonyl)-5-cyclohexa-1,5-dien-1-yl-N-methylhepta-1,4-dien-3-imine |
| SMILES | C=C(C(/C=C(\CC)C1=CCCC=C1)=N/C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23NO2S/c1-4-17(18-11-7-5-8-12-18)15-20(21-3)16(2)24(22,23)19-13-9-6-10-14-19/h6-7,9-15H,2,4-5,8H2,1,3H3/b17-15+,21-20+ |
| InChIKey | HMHXAXBDHGYCBP-SLIKNIJUSA-N |
| XLogP | 4.66 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|