C45H80O6 — CID 123832869
2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate (PubChem CID 123832869) has the molecular formula C45H80O6 and a molecular weight of 717.13 g/mol. Its IUPAC name is 2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate.
| Compound Name | 2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate |
|---|---|
| PubChem CID | 123832869 |
| Molecular Formula | C45H80O6 |
| Molecular Weight | 717.13 g/mol |
| Exact Mass | 716.60 |
| IUPAC Name | 2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate |
| SMILES | CCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCC |
| InChI | InChI=1S/C45H80O6/c1-4-7-10-13-16-19-20-21-22-23-24-27-29-32-35-38-44(47)50-41-42(51-45(48)39-36-33-30-26-18-15-12-9-6-3)40-49-43(46)37-34-31-28-25-17-14-11-8-5-2/h8-9,11-12,21-22,42H,4-7,10,13-20,23-41H2,1-3H3 |
| InChIKey | NURPHSOQYVDJJJ-UHFFFAOYSA-N |
| XLogP | 13.42 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.13 |
| LogP ≤ 5 | 13.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|