2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate

C45H80O6 — CID 123832869

IUPAC2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate
SMILESCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCC
InChIInChI=1S/C45H80O6/c1-4-7-10-13-16-19-20-21-22-23-24-27-29-32-35-38-44(47)50-41-42(51-45(48)39-36-33-30-26-18-15-12-9-6-3)40-49-43(46)37-34-31-28-25-17-14-11-8-5-2/h8-9,11-12,21-22,42H,4-7,10,13-20,23-41H2,1-3H3
InChIKeyNURPHSOQYVDJJJ-UHFFFAOYSA-N
MW717.13 g/mol
LogP13.42
Rot. Bonds38

About 2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate

2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate (PubChem CID 123832869) has the molecular formula C45H80O6 and a molecular weight of 717.13 g/mol. Its IUPAC name is 2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate.

Molecular Properties

Compound Name2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate
PubChem CID123832869
Molecular FormulaC45H80O6
Molecular Weight717.13 g/mol
Exact Mass716.60
IUPAC Name2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate
SMILESCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCC
InChIInChI=1S/C45H80O6/c1-4-7-10-13-16-19-20-21-22-23-24-27-29-32-35-38-44(47)50-41-42(51-45(48)39-36-33-30-26-18-15-12-9-6-3)40-49-43(46)37-34-31-28-25-17-14-11-8-5-2/h8-9,11-12,21-22,42H,4-7,10,13-20,23-41H2,1-3H3
InChIKeyNURPHSOQYVDJJJ-UHFFFAOYSA-N
XLogP13.42
TPSA78.90 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds38
Heavy Atoms51
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500717.13
LogP ≤ 513.42
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Frequently Asked Questions

What is the IUPAC name of 2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate?
The IUPAC name of 2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate (CID 123832869) is 2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate.
What is the SMILES notation for 2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate?
The canonical SMILES for 2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate is CCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCC.
What is the InChIKey of 2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate?
The InChIKey is NURPHSOQYVDJJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H80O6/c1-4-7-10-13-16-19-20-21-22-23-24-27-29-32-35-38-44(47)50-41-42(51-45(48)39-36-33-30-26-18-15-12-9-6-3)40-49-43(46)37-34-31-28-25-17-14-11-8-5-2/h8-9,11-12,21-22,42H,4-7,10,13-20,23-41H2,1-3H3.
What are the key properties of 2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate?
2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate has a molecular weight of 717.13 g/mol, XLogP of 13.42, 38 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(dodec-9-enoyloxy)propyl octadec-9-enoate is sourced from PubChem (CID 123832869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).