C22H33N3O3S — CID 123833137
N-ethyl-1-[2-(4-methyl-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-5-yl)ethyl]-N-(1,2-thiazol-5-yl)piperidine-4-carboxamide (PubChem CID 123833137) has the molecular formula C22H33N3O3S and a molecular weight of 419.59 g/mol. Its IUPAC name is N-ethyl-1-[2-(4-methyl-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-5-yl)ethyl]-N-(1,2-thiazol-5-yl)piperidine-4-carboxamide.
| Compound Name | N-ethyl-1-[2-(4-methyl-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-5-yl)ethyl]-N-(1,2-thiazol-5-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 123833137 |
| Molecular Formula | C22H33N3O3S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-ethyl-1-[2-(4-methyl-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-5-yl)ethyl]-N-(1,2-thiazol-5-yl)piperidine-4-carboxamide |
| SMILES | CCN(C(=O)C1CCN(CCC2CCC3C(=O)OCC3C2C)CC1)c1ccns1 |
| InChI | InChI=1S/C22H33N3O3S/c1-3-25(20-6-10-23-29-20)21(26)17-8-12-24(13-9-17)11-7-16-4-5-18-19(15(16)2)14-28-22(18)27/h6,10,15-19H,3-5,7-9,11-14H2,1-2H3 |
| InChIKey | DFTRKZQLCNMSAI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |