C24H39NO9 — CID 123833194
[5-amino-4-hydroxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexan-3-yl] 6-phenylhexanoate (PubChem CID 123833194) has the molecular formula C24H39NO9 and a molecular weight of 485.57 g/mol. Its IUPAC name is [5-amino-4-hydroxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexan-3-yl] 6-phenylhexanoate.
| Compound Name | [5-amino-4-hydroxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexan-3-yl] 6-phenylhexanoate |
|---|---|
| PubChem CID | 123833194 |
| Molecular Formula | C24H39NO9 |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | [5-amino-4-hydroxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexan-3-yl] 6-phenylhexanoate |
| SMILES | CCC(OC(=O)CCCCCc1ccccc1)C(O)C(N)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C24H39NO9/c1-2-17(33-19(27)12-8-4-7-11-15-9-5-3-6-10-15)20(28)16(25)14-32-24-23(31)22(30)21(29)18(13-26)34-24/h3,5-6,9-10,16-18,20-24,26,28-31H,2,4,7-8,11-14,25H2,1H3 |
| InChIKey | XDSDXPJWMJZYQI-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 171.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|