About 1-ethyl-1-(3,5,5-trimethyl-3-propan-2-ylhex-1-en-2-yl)oxycyclopentane
1-ethyl-1-(3,5,5-trimethyl-3-propan-2-ylhex-1-en-2-yl)oxycyclopentane (PubChem CID 123833942) has the molecular formula C19H36O
and a molecular weight of 280.50 g/mol. Its IUPAC name is 1-ethyl-1-(3,5,5-trimethyl-3-propan-2-ylhex-1-en-2-yl)oxycyclopentane.
Molecular Properties
| Compound Name | 1-ethyl-1-(3,5,5-trimethyl-3-propan-2-ylhex-1-en-2-yl)oxycyclopentane |
| PubChem CID | 123833942 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | 1-ethyl-1-(3,5,5-trimethyl-3-propan-2-ylhex-1-en-2-yl)oxycyclopentane |
| SMILES | C=C(OC1(CC)CCCC1)C(C)(CC(C)(C)C)C(C)C |
| InChI | InChI=1S/C19H36O/c1-9-19(12-10-11-13-19)20-16(4)18(8,15(2)3)14-17(5,6)7/h15H,4,9-14H2,1-3,5-8H3 |
| InChIKey | BMAAUPBFFOEJHD-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1-(3,5,5-trimethyl-3-propan-2-ylhex-1-en-2-yl)oxycyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-(3,5,5-trimethyl-3-propan-2-ylhex-1-en-2-yl)oxycyclopentane?
The IUPAC name of 1-ethyl-1-(3,5,5-trimethyl-3-propan-2-ylhex-1-en-2-yl)oxycyclopentane (CID 123833942) is 1-ethyl-1-(3,5,5-trimethyl-3-propan-2-ylhex-1-en-2-yl)oxycyclopentane.
What is the SMILES notation for 1-ethyl-1-(3,5,5-trimethyl-3-propan-2-ylhex-1-en-2-yl)oxycyclopentane?
The canonical SMILES for 1-ethyl-1-(3,5,5-trimethyl-3-propan-2-ylhex-1-en-2-yl)oxycyclopentane is C=C(OC1(CC)CCCC1)C(C)(CC(C)(C)C)C(C)C.
What is the InChIKey of 1-ethyl-1-(3,5,5-trimethyl-3-propan-2-ylhex-1-en-2-yl)oxycyclopentane?
The InChIKey is BMAAUPBFFOEJHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O/c1-9-19(12-10-11-13-19)20-16(4)18(8,15(2)3)14-17(5,6)7/h15H,4,9-14H2,1-3,5-8H3.
What are the key properties of 1-ethyl-1-(3,5,5-trimethyl-3-propan-2-ylhex-1-en-2-yl)oxycyclopentane?
1-ethyl-1-(3,5,5-trimethyl-3-propan-2-ylhex-1-en-2-yl)oxycyclopentane has a molecular weight of 280.50 g/mol, XLogP of 6.34, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-(3,5,5-trimethyl-3-propan-2-ylhex-1-en-2-yl)oxycyclopentane is sourced from PubChem (CID 123833942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).