C24H30FN6O2+ — CID 123834257
[5-carbamoyl-3-fluoro-6-(quinolin-3-ylamino)-2-pyridinyl]-[3-(dimethylamino)oxan-4-yl]-dimethylazanium (PubChem CID 123834257) has the molecular formula C24H30FN6O2+ and a molecular weight of 453.54 g/mol. Its IUPAC name is [5-carbamoyl-3-fluoro-6-(quinolin-3-ylamino)-2-pyridinyl]-[3-(dimethylamino)oxan-4-yl]-dimethylazanium.
| Compound Name | [5-carbamoyl-3-fluoro-6-(quinolin-3-ylamino)-2-pyridinyl]-[3-(dimethylamino)oxan-4-yl]-dimethylazanium |
|---|---|
| PubChem CID | 123834257 |
| Molecular Formula | C24H30FN6O2+ |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | [5-carbamoyl-3-fluoro-6-(quinolin-3-ylamino)-2-pyridinyl]-[3-(dimethylamino)oxan-4-yl]-dimethylazanium |
| SMILES | CN(C)C1COCCC1[N+](C)(C)c1nc(Nc2cnc3ccccc3c2)c(C(N)=O)cc1F |
| InChI | InChI=1S/C24H29FN6O2/c1-30(2)20-14-33-10-9-21(20)31(3,4)24-18(25)12-17(22(26)32)23(29-24)28-16-11-15-7-5-6-8-19(15)27-13-16/h5-8,11-13,20-21H,9-10,14H2,1-4H3,(H2-,26,28,29,32)/p+1 |
| InChIKey | NMHZGFCJQFNZJZ-UHFFFAOYSA-O |
| XLogP | 2.90 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|