C22H15FN2O3S2 — CID 123834309
2-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-fluoro-5-(1,1,3-trioxo-1-benzothiophen-2-ylidene)pent-3-enenitrile (PubChem CID 123834309) has the molecular formula C22H15FN2O3S2 and a molecular weight of 438.51 g/mol. Its IUPAC name is 2-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-fluoro-5-(1,1,3-trioxo-1-benzothiophen-2-ylidene)pent-3-enenitrile.
| Compound Name | 2-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-fluoro-5-(1,1,3-trioxo-1-benzothiophen-2-ylidene)pent-3-enenitrile |
|---|---|
| PubChem CID | 123834309 |
| Molecular Formula | C22H15FN2O3S2 |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 2-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-fluoro-5-(1,1,3-trioxo-1-benzothiophen-2-ylidene)pent-3-enenitrile |
| SMILES | CCN1C(=C(C#N)C=C(F)C=C2C(=O)c3ccccc3S2(=O)=O)Sc2ccccc21 |
| InChI | InChI=1S/C22H15FN2O3S2/c1-2-25-17-8-4-5-9-18(17)29-22(25)14(13-24)11-15(23)12-20-21(26)16-7-3-6-10-19(16)30(20,27)28/h3-12H,2H2,1H3 |
| InChIKey | INFVNEOZCJWDCI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|