C26H27Cl2N5O4 — CID 123834571
tert-butyl N-[(3,4-dichlorophenyl)methyl]-N-[2-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)ethyl]carbamate (PubChem CID 123834571) has the molecular formula C26H27Cl2N5O4 and a molecular weight of 544.44 g/mol. Its IUPAC name is tert-butyl N-[(3,4-dichlorophenyl)methyl]-N-[2-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(3,4-dichlorophenyl)methyl]-N-[2-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 123834571 |
| Molecular Formula | C26H27Cl2N5O4 |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | tert-butyl N-[(3,4-dichlorophenyl)methyl]-N-[2-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)ethyl]carbamate |
| SMILES | Cc1cc2nc3[nH]c(=O)n(CCN(Cc4ccc(Cl)c(Cl)c4)C(=O)OC(C)(C)C)c(=O)c3nc2cc1C |
| InChI | InChI=1S/C26H27Cl2N5O4/c1-14-10-19-20(11-15(14)2)30-22-21(29-19)23(34)33(24(35)31-22)9-8-32(25(36)37-26(3,4)5)13-16-6-7-17(27)18(28)12-16/h6-7,10-12H,8-9,13H2,1-5H3,(H,30,31,35) |
| InChIKey | ABORGSYBKLFQSD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|