About N-(4-methoxypenta-1,3-dien-2-yl)ethenimine
N-(4-methoxypenta-1,3-dien-2-yl)ethenimine (PubChem CID 123834633) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is N-(4-methoxypenta-1,3-dien-2-yl)ethenimine.
Molecular Properties
| Compound Name | N-(4-methoxypenta-1,3-dien-2-yl)ethenimine |
| PubChem CID | 123834633 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | N-(4-methoxypenta-1,3-dien-2-yl)ethenimine |
| SMILES | C=C=NC(=C)C=C(C)OC |
| InChI | InChI=1S/C8H11NO/c1-5-9-7(2)6-8(3)10-4/h6H,1-2H2,3-4H3 |
| InChIKey | MVSURLODCOCNFI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(4-methoxypenta-1,3-dien-2-yl)ethenimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methoxypenta-1,3-dien-2-yl)ethenimine?
The IUPAC name of N-(4-methoxypenta-1,3-dien-2-yl)ethenimine (CID 123834633) is N-(4-methoxypenta-1,3-dien-2-yl)ethenimine.
What is the SMILES notation for N-(4-methoxypenta-1,3-dien-2-yl)ethenimine?
The canonical SMILES for N-(4-methoxypenta-1,3-dien-2-yl)ethenimine is C=C=NC(=C)C=C(C)OC.
What is the InChIKey of N-(4-methoxypenta-1,3-dien-2-yl)ethenimine?
The InChIKey is MVSURLODCOCNFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO/c1-5-9-7(2)6-8(3)10-4/h6H,1-2H2,3-4H3.
What are the key properties of N-(4-methoxypenta-1,3-dien-2-yl)ethenimine?
N-(4-methoxypenta-1,3-dien-2-yl)ethenimine has a molecular weight of 137.18 g/mol, XLogP of 1.91, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methoxypenta-1,3-dien-2-yl)ethenimine is sourced from PubChem (CID 123834633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).