About 2-cyclopropyl-6,7-dimethyl-1H-indole-3-carbaldehyde
2-cyclopropyl-6,7-dimethyl-1H-indole-3-carbaldehyde (PubChem CID 123834860) has the molecular formula C14H15NO
and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-cyclopropyl-6,7-dimethyl-1H-indole-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-cyclopropyl-6,7-dimethyl-1H-indole-3-carbaldehyde |
| PubChem CID | 123834860 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 2-cyclopropyl-6,7-dimethyl-1H-indole-3-carbaldehyde |
| SMILES | Cc1ccc2c(C=O)c(C3CC3)[nH]c2c1C |
| InChI | InChI=1S/C14H15NO/c1-8-3-6-11-12(7-16)14(10-4-5-10)15-13(11)9(8)2/h3,6-7,10,15H,4-5H2,1-2H3 |
| InChIKey | SFRWCKSRVLJEIG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropyl-6,7-dimethyl-1H-indole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-6,7-dimethyl-1H-indole-3-carbaldehyde?
The IUPAC name of 2-cyclopropyl-6,7-dimethyl-1H-indole-3-carbaldehyde (CID 123834860) is 2-cyclopropyl-6,7-dimethyl-1H-indole-3-carbaldehyde.
What is the SMILES notation for 2-cyclopropyl-6,7-dimethyl-1H-indole-3-carbaldehyde?
The canonical SMILES for 2-cyclopropyl-6,7-dimethyl-1H-indole-3-carbaldehyde is Cc1ccc2c(C=O)c(C3CC3)[nH]c2c1C.
What is the InChIKey of 2-cyclopropyl-6,7-dimethyl-1H-indole-3-carbaldehyde?
The InChIKey is SFRWCKSRVLJEIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO/c1-8-3-6-11-12(7-16)14(10-4-5-10)15-13(11)9(8)2/h3,6-7,10,15H,4-5H2,1-2H3.
What are the key properties of 2-cyclopropyl-6,7-dimethyl-1H-indole-3-carbaldehyde?
2-cyclopropyl-6,7-dimethyl-1H-indole-3-carbaldehyde has a molecular weight of 213.28 g/mol, XLogP of 3.47, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-6,7-dimethyl-1H-indole-3-carbaldehyde is sourced from PubChem (CID 123834860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).