C31H31BFN3O2 — CID 123834867
5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-carboximidoyl)-N-tritylpyridin-2-amine (PubChem CID 123834867) has the molecular formula C31H31BFN3O2 and a molecular weight of 507.42 g/mol. Its IUPAC name is 5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-carboximidoyl)-N-tritylpyridin-2-amine.
| Compound Name | 5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-carboximidoyl)-N-tritylpyridin-2-amine |
|---|---|
| PubChem CID | 123834867 |
| Molecular Formula | C31H31BFN3O2 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-carboximidoyl)-N-tritylpyridin-2-amine |
| SMILES | [H]/N=C(\B1OC(C)(C)C(C)(C)O1)c1cc(F)cnc1NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H31BFN3O2/c1-29(2)30(3,4)38-32(37-29)27(34)26-20-25(33)21-35-28(26)36-31(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-21,34H,1-4H3,(H,35,36)/b34-27- |
| InChIKey | UGXQCFKTMAMWSG-YLHCSOALSA-N |
| XLogP | 6.62 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|