C22H22F3N3O — CID 123835138
4-(2-hydroxy-3-methyl-5-phenyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl)-2-(trifluoromethyl)benzonitrile (PubChem CID 123835138) has the molecular formula C22H22F3N3O and a molecular weight of 401.43 g/mol. Its IUPAC name is 4-(2-hydroxy-3-methyl-5-phenyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(2-hydroxy-3-methyl-5-phenyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 123835138 |
| Molecular Formula | C22H22F3N3O |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 4-(2-hydroxy-3-methyl-5-phenyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl)-2-(trifluoromethyl)benzonitrile |
| SMILES | CN1C2CC(c3ccccc3)CCC2N(c2ccc(C#N)c(C(F)(F)F)c2)C1O |
| InChI | InChI=1S/C22H22F3N3O/c1-27-20-11-15(14-5-3-2-4-6-14)8-10-19(20)28(21(27)29)17-9-7-16(13-26)18(12-17)22(23,24)25/h2-7,9,12,15,19-21,29H,8,10-11H2,1H3 |
| InChIKey | SBDHFHVNBDKAGR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 50.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |