About 1-[4-[4-(1,3-thiazol-5-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine
1-[4-[4-(1,3-thiazol-5-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine (PubChem CID 123835373) has the molecular formula C19H17N3O2S
and a molecular weight of 351.43 g/mol. Its IUPAC name is 1-[4-[4-(1,3-thiazol-5-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine.
Molecular Properties
| Compound Name | 1-[4-[4-(1,3-thiazol-5-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine |
| PubChem CID | 123835373 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 1-[4-[4-(1,3-thiazol-5-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine |
| SMILES | [H]/N=C/C/C(=N\[H])c1ccc(Oc2ccc(OCc3cncs3)cc2)cc1 |
| InChI | InChI=1S/C19H17N3O2S/c20-10-9-19(21)14-1-3-16(4-2-14)24-17-7-5-15(6-8-17)23-12-18-11-22-13-25-18/h1-8,10-11,13,20-21H,9,12H2/b20-10+,21-19+ |
| InChIKey | OEIZIFOFRAUQNM-HBASTNHKSA-N |
| XLogP | 4.92 |
| TPSA | 79.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[4-(1,3-thiazol-5-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[4-(1,3-thiazol-5-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine?
The IUPAC name of 1-[4-[4-(1,3-thiazol-5-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine (CID 123835373) is 1-[4-[4-(1,3-thiazol-5-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine.
What is the SMILES notation for 1-[4-[4-(1,3-thiazol-5-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine?
The canonical SMILES for 1-[4-[4-(1,3-thiazol-5-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine is [H]/N=C/C/C(=N\[H])c1ccc(Oc2ccc(OCc3cncs3)cc2)cc1.
What is the InChIKey of 1-[4-[4-(1,3-thiazol-5-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine?
The InChIKey is OEIZIFOFRAUQNM-HBASTNHKSA-N. The full InChI is InChI=1S/C19H17N3O2S/c20-10-9-19(21)14-1-3-16(4-2-14)24-17-7-5-15(6-8-17)23-12-18-11-22-13-25-18/h1-8,10-11,13,20-21H,9,12H2/b20-10+,21-19+.
What are the key properties of 1-[4-[4-(1,3-thiazol-5-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine?
1-[4-[4-(1,3-thiazol-5-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine has a molecular weight of 351.43 g/mol, XLogP of 4.92, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[4-(1,3-thiazol-5-ylmethoxy)phenoxy]phenyl]propane-1,3-diimine is sourced from PubChem (CID 123835373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).