C23H30BNO5 — CID 123835679
(1S,2S)-2-hydroxy-2-[(3S)-3-phenyloxiran-2-yl]-1-[(2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione (PubChem CID 123835679) has the molecular formula C23H30BNO5 and a molecular weight of 411.31 g/mol. Its IUPAC name is (1S,2S)-2-hydroxy-2-[(3S)-3-phenyloxiran-2-yl]-1-[(2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione.
| Compound Name | (1S,2S)-2-hydroxy-2-[(3S)-3-phenyloxiran-2-yl]-1-[(2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione |
|---|---|
| PubChem CID | 123835679 |
| Molecular Formula | C23H30BNO5 |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | (1S,2S)-2-hydroxy-2-[(3S)-3-phenyloxiran-2-yl]-1-[(2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione |
| SMILES | C[C@@H]1C2C[C@@H](CC1[N@+]13CC(=O)C(C1)C(=O)O[B@@-]3(O)C1O[C@H]1c1ccccc1)C2(C)C |
| InChI | InChI=1S/C23H30BNO5/c1-13-17-9-15(23(17,2)3)10-18(13)25-11-16(19(26)12-25)22(27)30-24(25,28)21-20(29-21)14-7-5-4-6-8-14/h4-8,13,15-18,20-21,28H,9-12H2,1-3H3/t13-,15+,16?,17?,18?,20+,21?,24+,25-/m1/s1 |
| InChIKey | ZVJQGYHSHKCPHI-PPABLNOYSA-N |
| XLogP | 2.24 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|