C22H15F3N4O2S — CID 1238359
4-[[2-[[3-cyano-6-phenyl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetyl]amino]benzamide (PubChem CID 1238359) has the molecular formula C22H15F3N4O2S and a molecular weight of 456.45 g/mol. Its IUPAC name is 4-[[2-[[3-cyano-6-phenyl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[[3-cyano-6-phenyl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 1238359 |
| Molecular Formula | C22H15F3N4O2S |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 4-[[2-[[3-cyano-6-phenyl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetyl]amino]benzamide |
| SMILES | N#Cc1c(C(F)(F)F)cc(-c2ccccc2)nc1SCC(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C22H15F3N4O2S/c23-22(24,25)17-10-18(13-4-2-1-3-5-13)29-21(16(17)11-26)32-12-19(30)28-15-8-6-14(7-9-15)20(27)31/h1-10H,12H2,(H2,27,31)(H,28,30) |
| InChIKey | RWECLVCNLHXPIL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |