C26H26N4O — CID 123835921
6-[4-[(2R)-6-isocyano-1,2,3,4-tetrahydronaphthalen-2-yl]-3-oxopiperazin-1-yl]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile (PubChem CID 123835921) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is 6-[4-[(2R)-6-isocyano-1,2,3,4-tetrahydronaphthalen-2-yl]-3-oxopiperazin-1-yl]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile.
| Compound Name | 6-[4-[(2R)-6-isocyano-1,2,3,4-tetrahydronaphthalen-2-yl]-3-oxopiperazin-1-yl]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 123835921 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 6-[4-[(2R)-6-isocyano-1,2,3,4-tetrahydronaphthalen-2-yl]-3-oxopiperazin-1-yl]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)CC[C@@H](N1CCN(C3CCc4cc(C#N)ccc4C3)CC1=O)C2 |
| InChI | InChI=1S/C26H26N4O/c1-28-23-7-4-22-15-25(9-6-20(22)13-23)30-11-10-29(17-26(30)31)24-8-5-19-12-18(16-27)2-3-21(19)14-24/h2-4,7,12-13,24-25H,5-6,8-11,14-15,17H2/t24?,25-/m1/s1 |
| InChIKey | SOOMPIDVPJIAKV-WUBHUQEYSA-N |
| XLogP | 3.67 |
| TPSA | 51.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|