About 2-(8-methyl-2-tricyclo[4.2.0.01,4]octanyl)propan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate
2-(8-methyl-2-tricyclo[4.2.0.01,4]octanyl)propan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 123836226) has the molecular formula C22H38O2
and a molecular weight of 334.54 g/mol. Its IUPAC name is 2-(8-methyl-2-tricyclo[4.2.0.01,4]octanyl)propan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate.
Molecular Properties
| Compound Name | 2-(8-methyl-2-tricyclo[4.2.0.01,4]octanyl)propan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate |
| PubChem CID | 123836226 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | 2-(8-methyl-2-tricyclo[4.2.0.01,4]octanyl)propan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)CC(C)(C(=O)OC(C)(C)C1CC2CC3CC(C)C321)C(C)C |
| InChI | InChI=1S/C22H38O2/c1-13(2)12-21(8,14(3)4)19(23)24-20(6,7)18-11-17-10-16-9-15(5)22(16,17)18/h13-18H,9-12H2,1-8H3 |
| InChIKey | YYDICSOUGPHUMK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(8-methyl-2-tricyclo[4.2.0.01,4]octanyl)propan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-methyl-2-tricyclo[4.2.0.01,4]octanyl)propan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate?
The IUPAC name of 2-(8-methyl-2-tricyclo[4.2.0.01,4]octanyl)propan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate (CID 123836226) is 2-(8-methyl-2-tricyclo[4.2.0.01,4]octanyl)propan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate.
What is the SMILES notation for 2-(8-methyl-2-tricyclo[4.2.0.01,4]octanyl)propan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate?
The canonical SMILES for 2-(8-methyl-2-tricyclo[4.2.0.01,4]octanyl)propan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate is CC(C)CC(C)(C(=O)OC(C)(C)C1CC2CC3CC(C)C321)C(C)C.
What is the InChIKey of 2-(8-methyl-2-tricyclo[4.2.0.01,4]octanyl)propan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate?
The InChIKey is YYDICSOUGPHUMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38O2/c1-13(2)12-21(8,14(3)4)19(23)24-20(6,7)18-11-17-10-16-9-15(5)22(16,17)18/h13-18H,9-12H2,1-8H3.
What are the key properties of 2-(8-methyl-2-tricyclo[4.2.0.01,4]octanyl)propan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate?
2-(8-methyl-2-tricyclo[4.2.0.01,4]octanyl)propan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate has a molecular weight of 334.54 g/mol, XLogP of 5.70, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-methyl-2-tricyclo[4.2.0.01,4]octanyl)propan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate is sourced from PubChem (CID 123836226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).