About [6-but-3-en-2-yl-8-(2-methylbutyl)-3-(phosphanyloxymethyl)-1,5-dioxocan-3-yl]methanol
[6-but-3-en-2-yl-8-(2-methylbutyl)-3-(phosphanyloxymethyl)-1,5-dioxocan-3-yl]methanol (PubChem CID 123836518) has the molecular formula C17H33O4P
and a molecular weight of 332.42 g/mol. Its IUPAC name is [6-but-3-en-2-yl-8-(2-methylbutyl)-3-(phosphanyloxymethyl)-1,5-dioxocan-3-yl]methanol.
Molecular Properties
| Compound Name | [6-but-3-en-2-yl-8-(2-methylbutyl)-3-(phosphanyloxymethyl)-1,5-dioxocan-3-yl]methanol |
| PubChem CID | 123836518 |
| Molecular Formula | C17H33O4P |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | [6-but-3-en-2-yl-8-(2-methylbutyl)-3-(phosphanyloxymethyl)-1,5-dioxocan-3-yl]methanol |
| SMILES | C=CC(C)C1CC(CC(C)CC)OCC(CO)(COP)CO1 |
| InChI | InChI=1S/C17H33O4P/c1-5-13(3)7-15-8-16(14(4)6-2)20-11-17(9-18,10-19-15)12-21-22/h6,13-16,18H,2,5,7-12,22H2,1,3-4H3 |
| InChIKey | FHZNHPYAQDAKGI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [6-but-3-en-2-yl-8-(2-methylbutyl)-3-(phosphanyloxymethyl)-1,5-dioxocan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-but-3-en-2-yl-8-(2-methylbutyl)-3-(phosphanyloxymethyl)-1,5-dioxocan-3-yl]methanol?
The IUPAC name of [6-but-3-en-2-yl-8-(2-methylbutyl)-3-(phosphanyloxymethyl)-1,5-dioxocan-3-yl]methanol (CID 123836518) is [6-but-3-en-2-yl-8-(2-methylbutyl)-3-(phosphanyloxymethyl)-1,5-dioxocan-3-yl]methanol.
What is the SMILES notation for [6-but-3-en-2-yl-8-(2-methylbutyl)-3-(phosphanyloxymethyl)-1,5-dioxocan-3-yl]methanol?
The canonical SMILES for [6-but-3-en-2-yl-8-(2-methylbutyl)-3-(phosphanyloxymethyl)-1,5-dioxocan-3-yl]methanol is C=CC(C)C1CC(CC(C)CC)OCC(CO)(COP)CO1.
What is the InChIKey of [6-but-3-en-2-yl-8-(2-methylbutyl)-3-(phosphanyloxymethyl)-1,5-dioxocan-3-yl]methanol?
The InChIKey is FHZNHPYAQDAKGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33O4P/c1-5-13(3)7-15-8-16(14(4)6-2)20-11-17(9-18,10-19-15)12-21-22/h6,13-16,18H,2,5,7-12,22H2,1,3-4H3.
What are the key properties of [6-but-3-en-2-yl-8-(2-methylbutyl)-3-(phosphanyloxymethyl)-1,5-dioxocan-3-yl]methanol?
[6-but-3-en-2-yl-8-(2-methylbutyl)-3-(phosphanyloxymethyl)-1,5-dioxocan-3-yl]methanol has a molecular weight of 332.42 g/mol, XLogP of 3.20, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-but-3-en-2-yl-8-(2-methylbutyl)-3-(phosphanyloxymethyl)-1,5-dioxocan-3-yl]methanol is sourced from PubChem (CID 123836518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).