C27H31F3N4O5S — CID 123836584
3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-(trifluoromethyl)phenyl]-5-(1-ethyltriazol-4-yl)pentanoic acid (PubChem CID 123836584) has the molecular formula C27H31F3N4O5S and a molecular weight of 580.63 g/mol. Its IUPAC name is 3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-(trifluoromethyl)phenyl]-5-(1-ethyltriazol-4-yl)pentanoic acid.
| Compound Name | 3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-(trifluoromethyl)phenyl]-5-(1-ethyltriazol-4-yl)pentanoic acid |
|---|---|
| PubChem CID | 123836584 |
| Molecular Formula | C27H31F3N4O5S |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | 3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl)methyl]-4-(trifluoromethyl)phenyl]-5-(1-ethyltriazol-4-yl)pentanoic acid |
| SMILES | CCC1CN(Cc2cc(C(CCc3cn(CC)nn3)CC(=O)O)ccc2C(F)(F)F)S(=O)(=O)c2ccccc2O1 |
| InChI | InChI=1S/C27H31F3N4O5S/c1-3-22-17-34(40(37,38)25-8-6-5-7-24(25)39-22)15-20-13-18(10-12-23(20)27(28,29)30)19(14-26(35)36)9-11-21-16-33(4-2)32-31-21/h5-8,10,12-13,16,19,22H,3-4,9,11,14-15,17H2,1-2H3,(H,35,36) |
| InChIKey | GJIAQUPOXRGEOW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |