C9H10F3NO5S — CID 123837008
(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl) trifluoromethanesulfonate (PubChem CID 123837008) has the molecular formula C9H10F3NO5S and a molecular weight of 301.24 g/mol. Its IUPAC name is (1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl) trifluoromethanesulfonate.
| Compound Name | (1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 123837008 |
| Molecular Formula | C9H10F3NO5S |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | (1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(On1c(O)c2c(c1O)CCCC2)C(F)(F)F |
| InChI | InChI=1S/C9H10F3NO5S/c10-9(11,12)19(16,17)18-13-7(14)5-3-1-2-4-6(5)8(13)15/h14-15H,1-4H2 |
| InChIKey | JWUBLOPVBMOBLZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|