C23H30FIN4O3 — CID 123837358
tert-butyl N-[4-[1-carbamoyl-3-fluoro-6-(3-iodophenyl)imino-2,3-dihydropyridin-5-yl]cyclohexyl]carbamate (PubChem CID 123837358) has the molecular formula C23H30FIN4O3 and a molecular weight of 556.42 g/mol. Its IUPAC name is tert-butyl N-[4-[1-carbamoyl-3-fluoro-6-(3-iodophenyl)imino-2,3-dihydropyridin-5-yl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[1-carbamoyl-3-fluoro-6-(3-iodophenyl)imino-2,3-dihydropyridin-5-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 123837358 |
| Molecular Formula | C23H30FIN4O3 |
| Molecular Weight | 556.42 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | tert-butyl N-[4-[1-carbamoyl-3-fluoro-6-(3-iodophenyl)imino-2,3-dihydropyridin-5-yl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(C2=CC(F)CN(C(N)=O)/C2=N\c2cccc(I)c2)CC1 |
| InChI | InChI=1S/C23H30FIN4O3/c1-23(2,3)32-22(31)28-17-9-7-14(8-10-17)19-11-15(24)13-29(21(26)30)20(19)27-18-6-4-5-16(25)12-18/h4-6,11-12,14-15,17H,7-10,13H2,1-3H3,(H2,26,30)(H,28,31)/b27-20- |
| InChIKey | XAFMCEBCQDYUSJ-OOAXWGSJSA-N |
| XLogP | 5.06 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|