About 3-(oxolan-3-yl)-3,8-diazabicyclo[3.2.1]octan-8-amine
3-(oxolan-3-yl)-3,8-diazabicyclo[3.2.1]octan-8-amine (PubChem CID 123837497) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is 3-(oxolan-3-yl)-3,8-diazabicyclo[3.2.1]octan-8-amine.
Molecular Properties
| Compound Name | 3-(oxolan-3-yl)-3,8-diazabicyclo[3.2.1]octan-8-amine |
| PubChem CID | 123837497 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 3-(oxolan-3-yl)-3,8-diazabicyclo[3.2.1]octan-8-amine |
| SMILES | NN1C2CCC1CN(C1CCOC1)C2 |
| InChI | InChI=1S/C10H19N3O/c11-13-8-1-2-9(13)6-12(5-8)10-3-4-14-7-10/h8-10H,1-7,11H2 |
| InChIKey | WODLECYRJVEHJX-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 3-(oxolan-3-yl)-3,8-diazabicyclo[3.2.1]octan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxolan-3-yl)-3,8-diazabicyclo[3.2.1]octan-8-amine?
The IUPAC name of 3-(oxolan-3-yl)-3,8-diazabicyclo[3.2.1]octan-8-amine (CID 123837497) is 3-(oxolan-3-yl)-3,8-diazabicyclo[3.2.1]octan-8-amine.
What is the SMILES notation for 3-(oxolan-3-yl)-3,8-diazabicyclo[3.2.1]octan-8-amine?
The canonical SMILES for 3-(oxolan-3-yl)-3,8-diazabicyclo[3.2.1]octan-8-amine is NN1C2CCC1CN(C1CCOC1)C2.
What is the InChIKey of 3-(oxolan-3-yl)-3,8-diazabicyclo[3.2.1]octan-8-amine?
The InChIKey is WODLECYRJVEHJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O/c11-13-8-1-2-9(13)6-12(5-8)10-3-4-14-7-10/h8-10H,1-7,11H2.
What are the key properties of 3-(oxolan-3-yl)-3,8-diazabicyclo[3.2.1]octan-8-amine?
3-(oxolan-3-yl)-3,8-diazabicyclo[3.2.1]octan-8-amine has a molecular weight of 197.28 g/mol, XLogP of -0.20, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxolan-3-yl)-3,8-diazabicyclo[3.2.1]octan-8-amine is sourced from PubChem (CID 123837497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).