C32H40BN3O5 — CID 123838111
tert-butyl 4-[2-(isoquinolin-1-ylcarbamoyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxylate (PubChem CID 123838111) has the molecular formula C32H40BN3O5 and a molecular weight of 557.50 g/mol. Its IUPAC name is tert-butyl 4-[2-(isoquinolin-1-ylcarbamoyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(isoquinolin-1-ylcarbamoyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123838111 |
| Molecular Formula | C32H40BN3O5 |
| Molecular Weight | 557.50 g/mol |
| Exact Mass | 557.31 |
| IUPAC Name | tert-butyl 4-[2-(isoquinolin-1-ylcarbamoyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(B3OC(C)(C)C(C)(C)O3)ccc2C(=O)Nc2nccc3ccccc23)CC1 |
| InChI | InChI=1S/C32H40BN3O5/c1-30(2,3)39-29(38)36-18-15-22(16-19-36)26-20-23(33-40-31(4,5)32(6,7)41-33)12-13-25(26)28(37)35-27-24-11-9-8-10-21(24)14-17-34-27/h8-14,17,20,22H,15-16,18-19H2,1-7H3,(H,34,35,37) |
| InChIKey | AOVXAKUSKZAHIC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.50 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|