C19H29NO6SSi — CID 123838366
tert-butyl 2-[1,1,3-trioxo-2-(2-trimethylsilylethoxymethyl)-1,2-benzothiazol-6-yl]acetate (PubChem CID 123838366) has the molecular formula C19H29NO6SSi and a molecular weight of 427.60 g/mol. Its IUPAC name is tert-butyl 2-[1,1,3-trioxo-2-(2-trimethylsilylethoxymethyl)-1,2-benzothiazol-6-yl]acetate.
| Compound Name | tert-butyl 2-[1,1,3-trioxo-2-(2-trimethylsilylethoxymethyl)-1,2-benzothiazol-6-yl]acetate |
|---|---|
| PubChem CID | 123838366 |
| Molecular Formula | C19H29NO6SSi |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | tert-butyl 2-[1,1,3-trioxo-2-(2-trimethylsilylethoxymethyl)-1,2-benzothiazol-6-yl]acetate |
| SMILES | CC(C)(C)OC(=O)Cc1ccc2c(c1)S(=O)(=O)N(COCC[Si](C)(C)C)C2=O |
| InChI | InChI=1S/C19H29NO6SSi/c1-19(2,3)26-17(21)12-14-7-8-15-16(11-14)27(23,24)20(18(15)22)13-25-9-10-28(4,5)6/h7-8,11H,9-10,12-13H2,1-6H3 |
| InChIKey | GTQRCDYWCGFIRT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|