C29H36N6O — CID 123838771
4-[8-amino-3-[1-(2-methylbutyl)piperidin-3-yl]imidazo[1,5-a]pyrazin-1-yl]-N-hexa-1,3,5-trien-2-ylbenzamide (PubChem CID 123838771) has the molecular formula C29H36N6O and a molecular weight of 484.65 g/mol. Its IUPAC name is 4-[8-amino-3-[1-(2-methylbutyl)piperidin-3-yl]imidazo[1,5-a]pyrazin-1-yl]-N-hexa-1,3,5-trien-2-ylbenzamide.
| Compound Name | 4-[8-amino-3-[1-(2-methylbutyl)piperidin-3-yl]imidazo[1,5-a]pyrazin-1-yl]-N-hexa-1,3,5-trien-2-ylbenzamide |
|---|---|
| PubChem CID | 123838771 |
| Molecular Formula | C29H36N6O |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | 4-[8-amino-3-[1-(2-methylbutyl)piperidin-3-yl]imidazo[1,5-a]pyrazin-1-yl]-N-hexa-1,3,5-trien-2-ylbenzamide |
| SMILES | C=CC=CC(=C)NC(=O)c1ccc(-c2nc(C3CCCN(CC(C)CC)C3)n3ccnc(N)c23)cc1 |
| InChI | InChI=1S/C29H36N6O/c1-5-7-9-21(4)32-29(36)23-13-11-22(12-14-23)25-26-27(30)31-15-17-35(26)28(33-25)24-10-8-16-34(19-24)18-20(3)6-2/h5,7,9,11-15,17,20,24H,1,4,6,8,10,16,18-19H2,2-3H3,(H2,30,31)(H,32,36) |
| InChIKey | RXHYKOCWGGYETE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 88.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|