About 5-[(2,2-difluorocyclopropyl)methoxy]pyridin-2-amine
5-[(2,2-difluorocyclopropyl)methoxy]pyridin-2-amine (PubChem CID 123838873) has the molecular formula C9H10F2N2O
and a molecular weight of 200.19 g/mol. Its IUPAC name is 5-[(2,2-difluorocyclopropyl)methoxy]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-[(2,2-difluorocyclopropyl)methoxy]pyridin-2-amine |
| PubChem CID | 123838873 |
| Molecular Formula | C9H10F2N2O |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 5-[(2,2-difluorocyclopropyl)methoxy]pyridin-2-amine |
| SMILES | Nc1ccc(OCC2CC2(F)F)cn1 |
| InChI | InChI=1S/C9H10F2N2O/c10-9(11)3-6(9)5-14-7-1-2-8(12)13-4-7/h1-2,4,6H,3,5H2,(H2,12,13) |
| InChIKey | PUBCOJHDXQYRTQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(2,2-difluorocyclopropyl)methoxy]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,2-difluorocyclopropyl)methoxy]pyridin-2-amine?
The IUPAC name of 5-[(2,2-difluorocyclopropyl)methoxy]pyridin-2-amine (CID 123838873) is 5-[(2,2-difluorocyclopropyl)methoxy]pyridin-2-amine.
What is the SMILES notation for 5-[(2,2-difluorocyclopropyl)methoxy]pyridin-2-amine?
The canonical SMILES for 5-[(2,2-difluorocyclopropyl)methoxy]pyridin-2-amine is Nc1ccc(OCC2CC2(F)F)cn1.
What is the InChIKey of 5-[(2,2-difluorocyclopropyl)methoxy]pyridin-2-amine?
The InChIKey is PUBCOJHDXQYRTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2N2O/c10-9(11)3-6(9)5-14-7-1-2-8(12)13-4-7/h1-2,4,6H,3,5H2,(H2,12,13).
What are the key properties of 5-[(2,2-difluorocyclopropyl)methoxy]pyridin-2-amine?
5-[(2,2-difluorocyclopropyl)methoxy]pyridin-2-amine has a molecular weight of 200.19 g/mol, XLogP of 1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,2-difluorocyclopropyl)methoxy]pyridin-2-amine is sourced from PubChem (CID 123838873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).