C21H28O2S — CID 123839051
methyl 2-(2-methyl-3,4,5,6,7,8,9,10-octahydro-2H-cyclonona[b]thiophen-7-yl)-2-phenylacetate (PubChem CID 123839051) has the molecular formula C21H28O2S and a molecular weight of 344.52 g/mol. Its IUPAC name is methyl 2-(2-methyl-3,4,5,6,7,8,9,10-octahydro-2H-cyclonona[b]thiophen-7-yl)-2-phenylacetate.
| Compound Name | methyl 2-(2-methyl-3,4,5,6,7,8,9,10-octahydro-2H-cyclonona[b]thiophen-7-yl)-2-phenylacetate |
|---|---|
| PubChem CID | 123839051 |
| Molecular Formula | C21H28O2S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | methyl 2-(2-methyl-3,4,5,6,7,8,9,10-octahydro-2H-cyclonona[b]thiophen-7-yl)-2-phenylacetate |
| SMILES | COC(=O)C(c1ccccc1)C1CCCC2=C(CCC1)SC(C)C2 |
| InChI | InChI=1S/C21H28O2S/c1-15-14-18-12-6-10-17(11-7-13-19(18)24-15)20(21(22)23-2)16-8-4-3-5-9-16/h3-5,8-9,15,17,20H,6-7,10-14H2,1-2H3 |
| InChIKey | WRLUMNAYSIOIJH-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |