C25H30ClNO3 — CID 123839158
(4-chloro-3-methylphenyl)-(4-ethoxy-2-phenyl-1-oxa-9-azaspiro[5.5]undecan-9-yl)methanone (PubChem CID 123839158) has the molecular formula C25H30ClNO3 and a molecular weight of 427.97 g/mol. Its IUPAC name is (4-chloro-3-methylphenyl)-(4-ethoxy-2-phenyl-1-oxa-9-azaspiro[5.5]undecan-9-yl)methanone.
| Compound Name | (4-chloro-3-methylphenyl)-(4-ethoxy-2-phenyl-1-oxa-9-azaspiro[5.5]undecan-9-yl)methanone |
|---|---|
| PubChem CID | 123839158 |
| Molecular Formula | C25H30ClNO3 |
| Molecular Weight | 427.97 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (4-chloro-3-methylphenyl)-(4-ethoxy-2-phenyl-1-oxa-9-azaspiro[5.5]undecan-9-yl)methanone |
| SMILES | CCOC1CC(c2ccccc2)OC2(CCN(C(=O)c3ccc(Cl)c(C)c3)CC2)C1 |
| InChI | InChI=1S/C25H30ClNO3/c1-3-29-21-16-23(19-7-5-4-6-8-19)30-25(17-21)11-13-27(14-12-25)24(28)20-9-10-22(26)18(2)15-20/h4-10,15,21,23H,3,11-14,16-17H2,1-2H3 |
| InChIKey | OSGBSFSWDBMQBN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.97 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |