About [4,4-dimethyl-2-(2-methylbutan-2-yl)hexyl]-dimethyl-trimethylsilyloxysilane
[4,4-dimethyl-2-(2-methylbutan-2-yl)hexyl]-dimethyl-trimethylsilyloxysilane (PubChem CID 123839299) has the molecular formula C18H42OSi2
and a molecular weight of 330.71 g/mol. Its IUPAC name is [4,4-dimethyl-2-(2-methylbutan-2-yl)hexyl]-dimethyl-trimethylsilyloxysilane.
Molecular Properties
| Compound Name | [4,4-dimethyl-2-(2-methylbutan-2-yl)hexyl]-dimethyl-trimethylsilyloxysilane |
| PubChem CID | 123839299 |
| Molecular Formula | C18H42OSi2 |
| Molecular Weight | 330.71 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | [4,4-dimethyl-2-(2-methylbutan-2-yl)hexyl]-dimethyl-trimethylsilyloxysilane |
| SMILES | CCC(C)(C)CC(C[Si](C)(C)O[Si](C)(C)C)C(C)(C)CC |
| InChI | InChI=1S/C18H42OSi2/c1-12-17(3,4)14-16(18(5,6)13-2)15-21(10,11)19-20(7,8)9/h16H,12-15H2,1-11H3 |
| InChIKey | QLMGREWJAWXCAX-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.71 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4,4-dimethyl-2-(2-methylbutan-2-yl)hexyl]-dimethyl-trimethylsilyloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4-dimethyl-2-(2-methylbutan-2-yl)hexyl]-dimethyl-trimethylsilyloxysilane?
The IUPAC name of [4,4-dimethyl-2-(2-methylbutan-2-yl)hexyl]-dimethyl-trimethylsilyloxysilane (CID 123839299) is [4,4-dimethyl-2-(2-methylbutan-2-yl)hexyl]-dimethyl-trimethylsilyloxysilane.
What is the SMILES notation for [4,4-dimethyl-2-(2-methylbutan-2-yl)hexyl]-dimethyl-trimethylsilyloxysilane?
The canonical SMILES for [4,4-dimethyl-2-(2-methylbutan-2-yl)hexyl]-dimethyl-trimethylsilyloxysilane is CCC(C)(C)CC(C[Si](C)(C)O[Si](C)(C)C)C(C)(C)CC.
What is the InChIKey of [4,4-dimethyl-2-(2-methylbutan-2-yl)hexyl]-dimethyl-trimethylsilyloxysilane?
The InChIKey is QLMGREWJAWXCAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H42OSi2/c1-12-17(3,4)14-16(18(5,6)13-2)15-21(10,11)19-20(7,8)9/h16H,12-15H2,1-11H3.
What are the key properties of [4,4-dimethyl-2-(2-methylbutan-2-yl)hexyl]-dimethyl-trimethylsilyloxysilane?
[4,4-dimethyl-2-(2-methylbutan-2-yl)hexyl]-dimethyl-trimethylsilyloxysilane has a molecular weight of 330.71 g/mol, XLogP of 6.92, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-dimethyl-2-(2-methylbutan-2-yl)hexyl]-dimethyl-trimethylsilyloxysilane is sourced from PubChem (CID 123839299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).