C7H20O4Si4 — CID 123839311
2-ethenyl-2,4,4,6,6-pentamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 123839311) has the molecular formula C7H20O4Si4 and a molecular weight of 280.58 g/mol. Its IUPAC name is 2-ethenyl-2,4,4,6,6-pentamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2-ethenyl-2,4,4,6,6-pentamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 123839311 |
| Molecular Formula | C7H20O4Si4 |
| Molecular Weight | 280.58 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 2-ethenyl-2,4,4,6,6-pentamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C=C[Si]1(C)O[SiH2]O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C7H20O4Si4/c1-7-15(6)9-12-8-13(2,3)10-14(4,5)11-15/h7H,1,12H2,2-6H3 |
| InChIKey | HXKMJGARGBCRAD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.58 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|