About 1-butan-2-yl-2-ethylidene-1,3-dimethylcyclopropane
1-butan-2-yl-2-ethylidene-1,3-dimethylcyclopropane (PubChem CID 123839350) has the molecular formula C11H20
and a molecular weight of 152.28 g/mol. Its IUPAC name is 1-butan-2-yl-2-ethylidene-1,3-dimethylcyclopropane.
Molecular Properties
| Compound Name | 1-butan-2-yl-2-ethylidene-1,3-dimethylcyclopropane |
| PubChem CID | 123839350 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | 1-butan-2-yl-2-ethylidene-1,3-dimethylcyclopropane |
| SMILES | CC=C1C(C)C1(C)C(C)CC |
| InChI | InChI=1S/C11H20/c1-6-8(3)11(5)9(4)10(11)7-2/h7-9H,6H2,1-5H3 |
| InChIKey | OLCQJUXGZULJFO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-butan-2-yl-2-ethylidene-1,3-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-2-ethylidene-1,3-dimethylcyclopropane?
The IUPAC name of 1-butan-2-yl-2-ethylidene-1,3-dimethylcyclopropane (CID 123839350) is 1-butan-2-yl-2-ethylidene-1,3-dimethylcyclopropane.
What is the SMILES notation for 1-butan-2-yl-2-ethylidene-1,3-dimethylcyclopropane?
The canonical SMILES for 1-butan-2-yl-2-ethylidene-1,3-dimethylcyclopropane is CC=C1C(C)C1(C)C(C)CC.
What is the InChIKey of 1-butan-2-yl-2-ethylidene-1,3-dimethylcyclopropane?
The InChIKey is OLCQJUXGZULJFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20/c1-6-8(3)11(5)9(4)10(11)7-2/h7-9H,6H2,1-5H3.
What are the key properties of 1-butan-2-yl-2-ethylidene-1,3-dimethylcyclopropane?
1-butan-2-yl-2-ethylidene-1,3-dimethylcyclopropane has a molecular weight of 152.28 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-2-ethylidene-1,3-dimethylcyclopropane is sourced from PubChem (CID 123839350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).