C25H31N8O+ — CID 123839359
[[[5-[2-[4-[(4-cyano-2,3-dihydro-1H-inden-1-yl)methyl]piperazin-1-yl]-2-oxoethyl]-2-pyridinyl]-methylamino]diazenyl]-methyl-methylideneazanium (PubChem CID 123839359) has the molecular formula C25H31N8O+ and a molecular weight of 459.58 g/mol. Its IUPAC name is [[[5-[2-[4-[(4-cyano-2,3-dihydro-1H-inden-1-yl)methyl]piperazin-1-yl]-2-oxoethyl]-2-pyridinyl]-methylamino]diazenyl]-methyl-methylideneazanium.
| Compound Name | [[[5-[2-[4-[(4-cyano-2,3-dihydro-1H-inden-1-yl)methyl]piperazin-1-yl]-2-oxoethyl]-2-pyridinyl]-methylamino]diazenyl]-methyl-methylideneazanium |
|---|---|
| PubChem CID | 123839359 |
| Molecular Formula | C25H31N8O+ |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | [[[5-[2-[4-[(4-cyano-2,3-dihydro-1H-inden-1-yl)methyl]piperazin-1-yl]-2-oxoethyl]-2-pyridinyl]-methylamino]diazenyl]-methyl-methylideneazanium |
| SMILES | C=[N+](C)N=NN(C)c1ccc(CC(=O)N2CCN(CC3CCc4c(C#N)cccc43)CC2)cn1 |
| InChI | InChI=1S/C25H31N8O/c1-30(2)28-29-31(3)24-10-7-19(17-27-24)15-25(34)33-13-11-32(12-14-33)18-21-8-9-23-20(16-26)5-4-6-22(21)23/h4-7,10,17,21H,1,8-9,11-15,18H2,2-3H3/q+1 |
| InChIKey | FWEWYNLWXKGZLS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 91.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|