About 1-cyclopentyl-6-methyl-2,6-dihydropyridin-3-imine
1-cyclopentyl-6-methyl-2,6-dihydropyridin-3-imine (PubChem CID 123839937) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-cyclopentyl-6-methyl-2,6-dihydropyridin-3-imine.
Molecular Properties
| Compound Name | 1-cyclopentyl-6-methyl-2,6-dihydropyridin-3-imine |
| PubChem CID | 123839937 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-cyclopentyl-6-methyl-2,6-dihydropyridin-3-imine |
| SMILES | [H]/N=C1\C=CC(C)N(C2CCCC2)C1 |
| InChI | InChI=1S/C11H18N2/c1-9-6-7-10(12)8-13(9)11-4-2-3-5-11/h6-7,9,11-12H,2-5,8H2,1H3/b12-10+ |
| InChIKey | GTFMGUMORUBZIP-ZRDIBKRKSA-N |
| XLogP | 2.21 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentyl-6-methyl-2,6-dihydropyridin-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-6-methyl-2,6-dihydropyridin-3-imine?
The IUPAC name of 1-cyclopentyl-6-methyl-2,6-dihydropyridin-3-imine (CID 123839937) is 1-cyclopentyl-6-methyl-2,6-dihydropyridin-3-imine.
What is the SMILES notation for 1-cyclopentyl-6-methyl-2,6-dihydropyridin-3-imine?
The canonical SMILES for 1-cyclopentyl-6-methyl-2,6-dihydropyridin-3-imine is [H]/N=C1\C=CC(C)N(C2CCCC2)C1.
What is the InChIKey of 1-cyclopentyl-6-methyl-2,6-dihydropyridin-3-imine?
The InChIKey is GTFMGUMORUBZIP-ZRDIBKRKSA-N. The full InChI is InChI=1S/C11H18N2/c1-9-6-7-10(12)8-13(9)11-4-2-3-5-11/h6-7,9,11-12H,2-5,8H2,1H3/b12-10+.
What are the key properties of 1-cyclopentyl-6-methyl-2,6-dihydropyridin-3-imine?
1-cyclopentyl-6-methyl-2,6-dihydropyridin-3-imine has a molecular weight of 178.28 g/mol, XLogP of 2.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-6-methyl-2,6-dihydropyridin-3-imine is sourced from PubChem (CID 123839937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).